CAS 34490-00-1 is the registry number for 2-Amino-n-(2,4-dichlorophenyl)benzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-N-(2,4-dichlorophenyl)benzamide (CAS 34490-00-1) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: 2-amino-N-(2,4-dichlorophenyl)benzamide. InChIKey: GNGHRCOJLDAFAW-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | 2-amino-N-(2,4-dichlorophenyl)benzamide |
| InChIKey | GNGHRCOJLDAFAW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)