CAS 923775-59-1 is the registry number for 4-Chloro-N-(2-chlorobenzyl)picolinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-N-[(2-chlorophenyl)methyl]pyridine-2-carboxamide (CAS 923775-59-1) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: 4-chloro-N-[(2-chlorophenyl)methyl]pyridine-2-carboxamide. InChIKey: FGYCIDIRLZJUBP-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | 4-chloro-N-[(2-chlorophenyl)methyl]pyridine-2-carboxamide |
| InChIKey | FGYCIDIRLZJUBP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)C2=NC=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)