Products 293737-94-7
CAS 293737-94-7 is the registry number for N-(4-Aminophenyl)-2,4-dichlorobenzamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-(4-aminophenyl)-2,4-dichlorobenzamide (CAS 293737-94-7) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: N-(4-aminophenyl)-2,4-dichlorobenzamide. InChIKey: JFHQBECHISXXKM-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | N-(4-aminophenyl)-2,4-dichlorobenzamide |
| InChIKey | JFHQBECHISXXKM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC(=O)C2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)