CAS 425685-04-7 appears in our catalog under these names: 2,3-Dichloro-n-(pyridin-3-ylmethyl)benzamide, 95%, 2,3-dichloro-N-(pyridin-3-ylmethyl)benzamide, 98%, 98%, 2,3-dichloro-N-(pyridin-3-ylmethyl)benzamide, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2,3-dichloro-N-(pyridin-3-ylmethyl)benzamide (CAS 425685-04-7) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: 2,3-dichloro-N-(pyridin-3-ylmethyl)benzamide. InChIKey: HIVIRUUQLUMBIM-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | 2,3-dichloro-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | HIVIRUUQLUMBIM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)NCC2=CN=CC=C2 |
Computed by PubChem (NCBI)