CAS 293737-92-5 appears in our catalog under these names: N-(3-Aminophenyl)-2,4-dichlorobenzamide, 95%, N-(3-Aminophenyl)-2,4-dichlorobenzamide. Offered by: Combi-blocks, TRC. Available pack sizes: 1g, 5g, 2,5g.
N-(3-aminophenyl)-2,4-dichlorobenzamide (CAS 293737-92-5) is a chemical compound with the molecular formula C13H10Cl2N2O and a molecular weight of 281.13 g/mol. IUPAC name: N-(3-aminophenyl)-2,4-dichlorobenzamide. InChIKey: YDWMXPAZFFSOJJ-UHFFFAOYSA-N.
| Molecular formula | C13H10Cl2N2O |
|---|---|
| Molecular weight | 281.13 g/mol |
| IUPAC name | N-(3-aminophenyl)-2,4-dichlorobenzamide |
| InChIKey | YDWMXPAZFFSOJJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl)N |
Computed by PubChem (NCBI)