CAS 13958-93-5 appears in our catalog under these names: 3,5–Dichloroisonicotinic Acid, 3,5-Dichloroisonicotinic Acid, >98.0%(T), 3,5-Dichloroisonicotinic acid 97%, 3,5-Dichloropyridine-4-carboxylic acid, 98%, 98%, 3,5-Dichloroisonicotinic acid, 98%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 100g, 250mg.
3,5-dichloropyridine-4-carboxylic acid (CAS 13958-93-5) is a chemical compound with the molecular formula C6H3Cl2NO2 and a molecular weight of 192.00 g/mol. IUPAC name: 3,5-dichloropyridine-4-carboxylic acid. InChIKey: BUQPTOSHKHYHHB-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2NO2 |
|---|---|
| Molecular weight | 192.00 g/mol |
| IUPAC name | 3,5-dichloropyridine-4-carboxylic acid |
| InChIKey | BUQPTOSHKHYHHB-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C=N1)Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)