CAS 1396889-62-5 is the registry number for Bupropion impurity 6 (hydrochloride). Offered by: MedChemExpress. Available pack sizes: Get quote.
(1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride (CAS 1396889-62-5) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: YZHVQDVGTAELNB-PKKHVXKMSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | YZHVQDVGTAELNB-PKKHVXKMSA-N |
| SMILES | C[C@@H]([C@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)