CAS 80478-43-9 appears in our catalog under these names: erythro-Hydroxy Bupropion HCl, rac-erythro-Dihydro Bupropion Hydrochloride, >95% (HPLC), rac-erythro-Dihydro bupropion hydrochloride. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 50mg.
(1S,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride (CAS 80478-43-9) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (1S,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: YZHVQDVGTAELNB-WYUVZMMLSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (1S,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | YZHVQDVGTAELNB-WYUVZMMLSA-N |
| SMILES | C[C@H]([C@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)