CAS 1807920-88-2 appears in our catalog under these names: (2S)-2-{(1-(4-chlorophenyl)ethyl)amino}-3-methylbutan-1-ol hydrochloride, 95%, (2S)-2-{(1-(4-Chlorophenyl)ethyl)amino}-3-methylbutan-1-ol hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
(2S)-2-[1-(4-chlorophenyl)ethylamino]-3-methylbutan-1-ol;hydrochloride (CAS 1807920-88-2) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (2S)-2-[1-(4-chlorophenyl)ethylamino]-3-methylbutan-1-ol;hydrochloride. InChIKey: LFSUWFMGHMQVMM-XTBNCEIVSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (2S)-2-[1-(4-chlorophenyl)ethylamino]-3-methylbutan-1-ol;hydrochloride |
| InChIKey | LFSUWFMGHMQVMM-XTBNCEIVSA-N |
| SMILES | CC(C)[C@@H](CO)NC(C)C1=CC=C(C=C1)Cl.Cl |
Computed by PubChem (NCBI)