CAS 357637-18-4 appears in our catalog under these names: (R,R)-Dihydro Bupropion Hydrochloride, >95% (HPLC), (R,R)-Dihydro bupropion hydrochloride, Threo-dihydrobupropion (hydrochloride), 99.00%. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 50mg, 5mg, 25mg, 10mg, 5 mg, 1 mg.
(1R,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride (CAS 357637-18-4) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (1R,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: YZHVQDVGTAELNB-KATIXKQHSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (1R,2R)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | YZHVQDVGTAELNB-KATIXKQHSA-N |
| SMILES | C[C@H]([C@@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)