CAS 357628-62-7 is the registry number for (1R,2S)-erythro-Dihydro Bupropion Hydrochloride, >95% (HPLC). Offered by: TRC. Available pack sizes: 2,5mg, 25mg.
(1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride (CAS 357628-62-7) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: YZHVQDVGTAELNB-CSDGMEMJSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (1R,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | YZHVQDVGTAELNB-CSDGMEMJSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)