CAS 292055-71-1 appears in our catalog under these names: (S,S)-Dihydro Bupropion Hydrochloride, >95% (HPLC), threo-Dihydro Bupropion Hydrochloride, >95% (HPLC), (S,S)-Dihydro bupropion hydrochloride. Offered by: TRC, Biosynth. Available pack sizes: 50mg, 5mg, 10mg, 1mg, 25mg.
(1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride (CAS 292055-71-1) is a chemical compound with the molecular formula C13H21Cl2NO and a molecular weight of 278.21 g/mol. IUPAC name: (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride. InChIKey: YZHVQDVGTAELNB-PKKHVXKMSA-N.
| Molecular formula | C13H21Cl2NO |
|---|---|
| Molecular weight | 278.21 g/mol |
| IUPAC name | (1S,2S)-2-(tert-butylamino)-1-(3-chlorophenyl)propan-1-ol;hydrochloride |
| InChIKey | YZHVQDVGTAELNB-PKKHVXKMSA-N |
| SMILES | C[C@@H]([C@H](C1=CC(=CC=C1)Cl)O)NC(C)(C)C.Cl |
Computed by PubChem (NCBI)