CAS 1396962-17-6 appears in our catalog under these names: 3-Carbamoyl-2-(3,4-dimethylbenzenesulfonamido)propanoic acid, 95%, 3-Carbamoyl-2-(3,4-dimethylbenzenesulfonamido)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-4-oxobutanoic acid (CAS 1396962-17-6) is a chemical compound with the molecular formula C12H16N2O5S and a molecular weight of 300.33 g/mol. IUPAC name: 4-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-4-oxobutanoic acid. InChIKey: NQUGTHZFNYYWFN-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O5S |
|---|---|
| Molecular weight | 300.33 g/mol |
| IUPAC name | 4-amino-2-[(3,4-dimethylphenyl)sulfonylamino]-4-oxobutanoic acid |
| InChIKey | NQUGTHZFNYYWFN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)S(=O)(=O)NC(CC(=O)N)C(=O)O)C |
Computed by PubChem (NCBI)