Products 1398065-73-0
CAS 1398065-73-0 is the registry number for 2-(3,4-Dimethoxy-d6-phenyl)ethyl-1,1,2,2-d4-amine HCl, 99 atom % D, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,05g, 0,01g.
2-[3,4-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterioethanamine;hydrochloride (CAS 1398065-73-0) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 227.75 g/mol. IUPAC name: 2-[3,4-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterioethanamine;hydrochloride. InChIKey: WIOOTMZLCZPTDW-OCNRKMBFSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 227.75 g/mol |
| IUPAC name | 2-[3,4-bis(trideuteriomethoxy)phenyl]-1,1,2,2-tetradeuterioethanamine;hydrochloride |
| InChIKey | WIOOTMZLCZPTDW-OCNRKMBFSA-N |
| SMILES | [2H]C([2H])([2H])OC1=C(C=C(C=C1)C([2H])([2H])C([2H])([2H])N)OC([2H])([2H])[2H].Cl |
Computed by PubChem (NCBI)