Products 1400234-92-5
CAS 1400234-92-5 appears in our catalog under these names: Arabidopyl alcohol, Arabidopyl alcohol, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 5mg.
4-[(E)-3-hydroxyprop-1-enyl]-6-oxopyran-2-carboxylic acid (CAS 1400234-92-5) is a chemical compound with the molecular formula C9H8O5 and a molecular weight of 196.16 g/mol. IUPAC name: 4-[(E)-3-hydroxyprop-1-enyl]-6-oxopyran-2-carboxylic acid. InChIKey: JZWUYCGDMCRRTE-OWOJBTEDSA-N.
| Molecular formula | C9H8O5 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 4-[(E)-3-hydroxyprop-1-enyl]-6-oxopyran-2-carboxylic acid |
| InChIKey | JZWUYCGDMCRRTE-OWOJBTEDSA-N |
| SMILES | C1=C(C=C(OC1=O)C(=O)O)/C=C/CO |
Computed by PubChem (NCBI)