CAS 1401668-21-0 appears in our catalog under these names: H-Ser(tBu)-OBzl.HCl, 97%, 97%, Benzyl O-(tert-butyl)-L-serinate hydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g, 10g, 100g.
Benzyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride (CAS 1401668-21-0) is a chemical compound with the molecular formula C14H22ClNO3 and a molecular weight of 287.78 g/mol. IUPAC name: benzyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride. InChIKey: HOYYQVAARUYRFU-YDALLXLXSA-N.
| Molecular formula | C14H22ClNO3 |
|---|---|
| Molecular weight | 287.78 g/mol |
| IUPAC name | benzyl (2S)-2-amino-3-[(2-methylpropan-2-yl)oxy]propanoate;hydrochloride |
| InChIKey | HOYYQVAARUYRFU-YDALLXLXSA-N |
| SMILES | CC(C)(C)OC[C@@H](C(=O)OCC1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)