Products 72036-41-0
CAS 72036-41-0 is the registry number for 4'-Methyl-2,2':6',2''-terpyridine, 98%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-methyl-2,6-dipyridin-2-ylpyridine (CAS 72036-41-0) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-methyl-2,6-dipyridin-2-ylpyridine. InChIKey: UZUDKOHDONKQCH-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-methyl-2,6-dipyridin-2-ylpyridine |
| InChIKey | UZUDKOHDONKQCH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=C1)C2=CC=CC=N2)C3=CC=CC=N3 |
Computed by PubChem (NCBI)