CAS 299463-56-2 is the registry number for 4-([1,1'-Biphenyl]-4-yl)pyrimidin-2-amine, 95+%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
4-(4-phenylphenyl)pyrimidin-2-amine (CAS 299463-56-2) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-(4-phenylphenyl)pyrimidin-2-amine. InChIKey: OSVOLQJCSTWERU-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-(4-phenylphenyl)pyrimidin-2-amine |
| InChIKey | OSVOLQJCSTWERU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC(=NC=C3)N |
Computed by PubChem (NCBI)