Products 2940955-71-3
CAS 2940955-71-3 is the registry number for N-[(3-ethynylphenyl)methyl]-2H-indazol-6-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(3-ethynylphenyl)methyl]-1H-indazol-6-amine (CAS 2940955-71-3) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: N-[(3-ethynylphenyl)methyl]-1H-indazol-6-amine. InChIKey: XHCZODDCXKJIFG-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | N-[(3-ethynylphenyl)methyl]-1H-indazol-6-amine |
| InChIKey | XHCZODDCXKJIFG-UHFFFAOYSA-N |
| SMILES | C#CC1=CC=CC(=C1)CNC2=CC3=C(C=C2)C=NN3 |
Computed by PubChem (NCBI)