CAS 358721-70-7 appears in our catalog under these names: UBCS039/ 99.75% (existing batch purity), UBCS039, 4-(Pyridin-3-yl)-4,5-dihydropyrrolo[1,2-a]quinoxaline, 98%, 98%, UBCS039, 98.88%, 4-(PYRIDIN-3-YL)-4,5-DIHYDROPYRROLO[1,2-A]QUINOXALINE, ≥98%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 1g, 250mg.
4-pyridin-3-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline (CAS 358721-70-7) is a chemical compound with the molecular formula C16H13N3 and a molecular weight of 247.29 g/mol. IUPAC name: 4-pyridin-3-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline. InChIKey: BSOBGTYXYGHUTD-UHFFFAOYSA-N.
| Molecular formula | C16H13N3 |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 4-pyridin-3-yl-4,5-dihydropyrrolo[1,2-a]quinoxaline |
| InChIKey | BSOBGTYXYGHUTD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC(C3=CC=CN32)C4=CN=CC=C4 |
Computed by PubChem (NCBI)