Products 140885-51-4
CAS 140885-51-4 is the registry number for 3-(4-(dimethylamino)phenyl)-1-(pyridin-2-yl)prop-2-en-1-one, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g.
3-[4-(dimethylamino)phenyl]-1-pyridin-2-ylprop-2-en-1-one (CAS 140885-51-4) is a chemical compound with the molecular formula C16H16N2O and a molecular weight of 252.31 g/mol. IUPAC name: 3-[4-(dimethylamino)phenyl]-1-pyridin-2-ylprop-2-en-1-one. InChIKey: RQOIXZNDFXKOQY-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O |
|---|---|
| Molecular weight | 252.31 g/mol |
| IUPAC name | 3-[4-(dimethylamino)phenyl]-1-pyridin-2-ylprop-2-en-1-one |
| InChIKey | RQOIXZNDFXKOQY-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C=CC(=O)C2=CC=CC=N2 |
Computed by PubChem (NCBI)