Products 1409164-68-6
CAS 1409164-68-6 is the registry number for N-(3-Chlorophenyl)-5-cyano-2-methylbenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-chlorophenyl)-5-cyano-2-methylbenzenesulfonamide (CAS 1409164-68-6) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: N-(3-chlorophenyl)-5-cyano-2-methylbenzenesulfonamide. InChIKey: JNXUMZNUERGGRY-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | N-(3-chlorophenyl)-5-cyano-2-methylbenzenesulfonamide |
| InChIKey | JNXUMZNUERGGRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C#N)S(=O)(=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)