Products 815612-78-3
CAS 815612-78-3 is the registry number for 1-Benzoyl-3-(5-chloro-2-hydroxyphenyl)thiourea, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]benzamide (CAS 815612-78-3) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]benzamide. InChIKey: WHFXJMSBLHKYQJ-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | N-[(5-chloro-2-hydroxyphenyl)carbamothioyl]benzamide |
| InChIKey | WHFXJMSBLHKYQJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(=S)NC2=C(C=CC(=C2)Cl)O |
Computed by PubChem (NCBI)