CAS 875156-68-6 appears in our catalog under these names: 2-(Chloromethyl)-6-(4-methoxyphenyl)thieno[3,2-d]pyrimidin-4(1h)-one, 95%, 2-(Chloromethyl)-6-(4-methoxyphenyl)thieno(3,2-d)pyrimidin-4(1H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2-(chloromethyl)-6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one (CAS 875156-68-6) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: 2-(chloromethyl)-6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: XLUDIMYKVDCTEL-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | 2-(chloromethyl)-6-(4-methoxyphenyl)-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | XLUDIMYKVDCTEL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(S2)C(=O)NC(=N3)CCl |
Computed by PubChem (NCBI)