Products 2411250-59-2
CAS 2411250-59-2 is the registry number for AGPAT4-IN-1, 99.04%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 5 mg, 10mM/1mL, 25 mg, 50 mg.
N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-chloroacetamide (CAS 2411250-59-2) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-chloroacetamide. InChIKey: VXJXTEXIFFDVKR-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | N-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-2-chloroacetamide |
| InChIKey | VXJXTEXIFFDVKR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(S2)C3=CC=C(O3)CNC(=O)CCl |
Computed by PubChem (NCBI)