CAS 348640-05-1 appears in our catalog under these names: 4-Chloro-1-(4-tolylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 96%, 96%, N-Tosyl-4-chloro-7-azaindole, 96%, 4-Chloro-1-tosyl-1H-pyrrolo[2,3-b]pyridine, 95+%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g.
4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine (CAS 348640-05-1) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: 4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine. InChIKey: RXOUGGMZMDZDCE-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | 4-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine |
| InChIKey | RXOUGGMZMDZDCE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=CC3=C(C=CN=C32)Cl |
Computed by PubChem (NCBI)