CAS 744209-64-1 appears in our catalog under these names: 4–Chloro–2–methyl–1–(phenylsulfonyl)–1H–pyrrolo(2,3–b)pyridine, 1H-PYRROLO[2,3-B]PYRIDINE, 4-CHLORO-2-METHYL-1-(PHENYLSULFONYL)-, 95%, 95%, 4-Chloro-2-methyl-1-(phenylsulfonyl)-1H-pyrrolo[2,3-b]pyridine, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 5g, 100mg, 250mg, 1g.
1-(benzenesulfonyl)-4-chloro-2-methylpyrrolo[2,3-b]pyridine (CAS 744209-64-1) is a chemical compound with the molecular formula C14H11ClN2O2S and a molecular weight of 306.8 g/mol. IUPAC name: 1-(benzenesulfonyl)-4-chloro-2-methylpyrrolo[2,3-b]pyridine. InChIKey: UJAMAALRPFEDPW-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN2O2S |
|---|---|
| Molecular weight | 306.8 g/mol |
| IUPAC name | 1-(benzenesulfonyl)-4-chloro-2-methylpyrrolo[2,3-b]pyridine |
| InChIKey | UJAMAALRPFEDPW-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=CN=C2N1S(=O)(=O)C3=CC=CC=C3)Cl |
Computed by PubChem (NCBI)