CAS 1410093-53-6 appears in our catalog under these names: 5-(Benzyloxy)pyrazine-2-carboxylic acid, 98%, 5-(Benzyloxy)pyrazine-2-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 0,5g, 50mg.
5-phenylmethoxypyrazine-2-carboxylic acid (CAS 1410093-53-6) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 5-phenylmethoxypyrazine-2-carboxylic acid. InChIKey: VZTKYFPCWJAPRU-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 5-phenylmethoxypyrazine-2-carboxylic acid |
| InChIKey | VZTKYFPCWJAPRU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=NC=C(N=C2)C(=O)O |
Computed by PubChem (NCBI)