CAS 141388-49-0 is the registry number for Methyl 3-amino-4-(1h-imidazol-1-yl)benzoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 250mg.
Methyl 3-amino-4-imidazol-1-ylbenzoate (CAS 141388-49-0) is a chemical compound with the molecular formula C11H11N3O2 and a molecular weight of 217.22 g/mol. IUPAC name: methyl 3-amino-4-imidazol-1-ylbenzoate. InChIKey: ZXZVUUMPELAZOP-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O2 |
|---|---|
| Molecular weight | 217.22 g/mol |
| IUPAC name | methyl 3-amino-4-imidazol-1-ylbenzoate |
| InChIKey | ZXZVUUMPELAZOP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C=C1)N2C=CN=C2)N |
Computed by PubChem (NCBI)