Products 1414350-37-0
CAS 1414350-37-0 appears in our catalog under these names: 2,4,6–Trihydroxybenzene–1,3,5–tricarbaldehyde compound with benzene–1,4–diamine (1：1), 1,3,5-Triformylphloroglucinol-p-phenylenediamine copolymer, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 25mg, 500mg.
Benzene-1,4-diamine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde (CAS 1414350-37-0) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: benzene-1,4-diamine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde. InChIKey: DJOSTUFCDFIBRL-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | benzene-1,4-diamine;2,4,6-trihydroxybenzene-1,3,5-tricarbaldehyde |
| InChIKey | DJOSTUFCDFIBRL-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N.C(=O)C1=C(C(=C(C(=C1O)C=O)O)C=O)O |
Computed by PubChem (NCBI)