CAS 354562-11-1 is the registry number for CDA-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid (CAS 354562-11-1) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: 2-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid. InChIKey: KQLPXLDVNQRNAY-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 2-[3-[(1,3-dimethyl-2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]phenoxy]acetic acid |
| InChIKey | KQLPXLDVNQRNAY-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C(=CC2=CC(=CC=C2)OCC(=O)O)C(=O)N(C1=O)C |
Computed by PubChem (NCBI)