Products 1984832-92-9
CAS 1984832-92-9 is the registry number for 2–Acetamido–2–((2–oxo–1,2–dihydroquinolin–4–yl)methyl)malonic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg.
2-acetamido-2-[(2-oxo-1H-quinolin-4-yl)methyl]propanedioic acid (CAS 1984832-92-9) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: 2-acetamido-2-[(2-oxo-1H-quinolin-4-yl)methyl]propanedioic acid. InChIKey: IPDTZVOWGHSNIR-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 2-acetamido-2-[(2-oxo-1H-quinolin-4-yl)methyl]propanedioic acid |
| InChIKey | IPDTZVOWGHSNIR-UHFFFAOYSA-N |
| SMILES | CC(=O)NC(CC1=CC(=O)NC2=CC=CC=C21)(C(=O)O)C(=O)O |
Computed by PubChem (NCBI)