Products 2226201-24-5
CAS 2226201-24-5 appears in our catalog under these names: GPR35 agonist 5, GPR35 agonist 5, 98.86%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, 50 mg, 10 mg, 25 mg, 5 mg, 100 mg.
4-[2-(4-hydroxyphenyl)propan-2-yl]-2,6-dinitrophenol (CAS 2226201-24-5) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: 4-[2-(4-hydroxyphenyl)propan-2-yl]-2,6-dinitrophenol. InChIKey: RMOCKJKLZTYVLR-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 4-[2-(4-hydroxyphenyl)propan-2-yl]-2,6-dinitrophenol |
| InChIKey | RMOCKJKLZTYVLR-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)O)C2=CC(=C(C(=C2)[N+](=O)[O-])O)[N+](=O)[O-] |
Computed by PubChem (NCBI)