CAS 74936-81-5 appears in our catalog under these names: Nifedipine Impurity 3, Nimodipine Impurity 12, 2,6-Dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic Acid. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg.
2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid (CAS 74936-81-5) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid. InChIKey: TZDPJNSHSWMCPN-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylic acid |
| InChIKey | TZDPJNSHSWMCPN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(C(=C(N1)C)C(=O)O)C2=CC(=CC=C2)[N+](=O)[O-])C(=O)O |
Computed by PubChem (NCBI)