CAS 2703760-41-0 is the registry number for 2-((2-(2,6-Dioxopiperidin-3-yl)-3-oxoisoindolin-4-yl)oxy)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]oxy]acetic acid (CAS 2703760-41-0) is a chemical compound with the molecular formula C15H14N2O6 and a molecular weight of 318.28 g/mol. IUPAC name: 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]oxy]acetic acid. InChIKey: ULFXJPUPLRNXAR-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6 |
|---|---|
| Molecular weight | 318.28 g/mol |
| IUPAC name | 2-[[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-4-yl]oxy]acetic acid |
| InChIKey | ULFXJPUPLRNXAR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C(=CC=C3)OCC(=O)O |
Computed by PubChem (NCBI)