CAS 1414860-36-8 appears in our catalog under these names: 3-Oxa-6-aza-bicyclo(3.1.1)heptane Tosylate, 3–Oxa–6–azabicyclo(3·1·1)heptane, 4–methylbenzene–1–sulfonic acid, 3-Oxa-6-aza-bicyclo[3.1.1]heptane tosylate, 98%(HPLC),RG, 98%(HPLC),RG, 3-Oxa-6-azabicyclo[3.1.1]heptane, 4-methylbenzene-1-sulfonic acid, 97%. Offered by: TRC, GLPBio, Chemat, Ambeed. Available pack sizes: 100mg, 50mg, 250mg, 1g.
4-methylbenzenesulfonic acid;3-oxa-6-azabicyclo[3.1.1]heptane (CAS 1414860-36-8) is a chemical compound with the molecular formula C12H17NO4S and a molecular weight of 271.33 g/mol. IUPAC name: 4-methylbenzenesulfonic acid;3-oxa-6-azabicyclo[3.1.1]heptane. InChIKey: LNDVYWDVZUQJSB-UHFFFAOYSA-N.
| Molecular formula | C12H17NO4S |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 4-methylbenzenesulfonic acid;3-oxa-6-azabicyclo[3.1.1]heptane |
| InChIKey | LNDVYWDVZUQJSB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.C1C2COCC1N2 |
Computed by PubChem (NCBI)