Products 1415750-29-6
CAS 1415750-29-6 is the registry number for (5-Fluoro-2,3-dihydro-1H-inden-1-yl)methanamine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(5-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine;hydrochloride (CAS 1415750-29-6) is a chemical compound with the molecular formula C10H13ClFN and a molecular weight of 201.67 g/mol. IUPAC name: (5-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine;hydrochloride. InChIKey: UINPEAKRZUVJIM-UHFFFAOYSA-N.
| Molecular formula | C10H13ClFN |
|---|---|
| Molecular weight | 201.67 g/mol |
| IUPAC name | (5-fluoro-2,3-dihydro-1H-inden-1-yl)methanamine;hydrochloride |
| InChIKey | UINPEAKRZUVJIM-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CN)C=CC(=C2)F.Cl |
Computed by PubChem (NCBI)