CAS 1416354-38-5 appears in our catalog under these names: 4-(2-Phenylpropan-2-yl)aniline hydrochloride, 95%, 4-(2-Phenylpropan-2-yl)aniline hydrochloride 95%, Benzenamine, 4-(1-methyl-1-phenylethyl)-, hydrochloride (1:1), 98%, 98%, 4-(2-Phenylpropan-2-yl)aniline hydrochloride, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
4-(2-phenylpropan-2-yl)aniline;hydrochloride (CAS 1416354-38-5) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: 4-(2-phenylpropan-2-yl)aniline;hydrochloride. InChIKey: YBRQYYRQXOERRQ-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 4-(2-phenylpropan-2-yl)aniline;hydrochloride |
| InChIKey | YBRQYYRQXOERRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=CC=C1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)