CAS 40691-66-5 appears in our catalog under these names: 2,2-Diphenylpropylamine hydrochloride, 95%, 2,2-Diphenylpropan-1-amine hydrochloride, 95+%, 2,2-Diphenylpropylamine hydrochloride, 98+% . Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar). Available pack sizes: 1g, 5g.
2,2-diphenylpropan-1-amine;hydrochloride (CAS 40691-66-5) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: 2,2-diphenylpropan-1-amine;hydrochloride. InChIKey: AASCJSPDUDWGGQ-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 2,2-diphenylpropan-1-amine;hydrochloride |
| InChIKey | AASCJSPDUDWGGQ-UHFFFAOYSA-N |
| SMILES | CC(CN)(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)