CAS 1422169-56-9 appears in our catalog under these names: (2,4-Dimethylphenyl)(phenyl)methanamine hydrochloride, 98%, (2,4-Dimethylphenyl)(phenyl)methanamine hydrochloride, (2,4-Dimethylphenyl)(phenyl)methanamine hydrochloride, 98%, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 2,5g, 100mg, 1g.
(2,4-dimethylphenyl)-phenylmethanamine;hydrochloride (CAS 1422169-56-9) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: (2,4-dimethylphenyl)-phenylmethanamine;hydrochloride. InChIKey: JLTHKPNILNLNGW-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | (2,4-dimethylphenyl)-phenylmethanamine;hydrochloride |
| InChIKey | JLTHKPNILNLNGW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(C2=CC=CC=C2)N)C.Cl |
Computed by PubChem (NCBI)