Products 2756331-97-0
CAS 2756331-97-0 is the registry number for 1-Chloro-6-(3-methylpentan-3-yl)isoquinoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-chloro-6-(3-methylpentan-3-yl)isoquinoline (CAS 2756331-97-0) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: 1-chloro-6-(3-methylpentan-3-yl)isoquinoline. InChIKey: CCMGDMOXIXPPOC-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 1-chloro-6-(3-methylpentan-3-yl)isoquinoline |
| InChIKey | CCMGDMOXIXPPOC-UHFFFAOYSA-N |
| SMILES | CCC(C)(CC)C1=CC2=C(C=C1)C(=NC=C2)Cl |
Computed by PubChem (NCBI)