Products 3204-68-0
CAS 3204-68-0 appears in our catalog under these names: Benzyldimethylphenylammonium chloride, 98%, N–Benzyl–N,N–dimethylbenzenaminium chloride, Benzyldimethylphenylammonium Chloride, >98.0%(HPLC)(T), N-Benzyl-N,N-dimethylbenzenaminium chloride 98%, N-Benzyl-N,N-dimethylbenzenaminium (chloride), 97.0%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, MedChemExpress. Available pack sizes: 1g, 25g, 100g, 5g, 500g, 1000g, 5 g, 25 g.
Benzyl-dimethyl-phenylazanium chloride (CAS 3204-68-0) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: benzyl-dimethyl-phenylazanium chloride. InChIKey: QLRKASHXFNIPLZ-UHFFFAOYSA-M.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | benzyl-dimethyl-phenylazanium chloride |
| InChIKey | QLRKASHXFNIPLZ-UHFFFAOYSA-M |
| SMILES | C[N+](C)(CC1=CC=CC=C1)C2=CC=CC=C2.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Benzyldimethylphenylammonium chloride, N-benzyl-N,N-dimethylbenzenaminium chloride, N-Benzyl-N,N-dimethylanilinium chloride, Leucotrope O, Benzyldimethylanilinium chloride, Phenyldimethylbenzylammonium chloride, Benzenemethanaminium, N,N-dimethyl-N-phenyl-, chloride, Dimethylbenzylanilinium chloride, Dimethylphenylbenzylammonium chloride, N,N-Dimethyl-N-phenylbenzenemethanaminium chloride