CAS 3139-54-6 is the registry number for 1,1-Diphenylpropan-2-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1,1-diphenylpropan-2-amine;hydrochloride (CAS 3139-54-6) is a chemical compound with the molecular formula C15H18ClN and a molecular weight of 247.76 g/mol. IUPAC name: 1,1-diphenylpropan-2-amine;hydrochloride. InChIKey: AKFNBTNILUNXAL-UHFFFAOYSA-N.
| Molecular formula | C15H18ClN |
|---|---|
| Molecular weight | 247.76 g/mol |
| IUPAC name | 1,1-diphenylpropan-2-amine;hydrochloride |
| InChIKey | AKFNBTNILUNXAL-UHFFFAOYSA-N |
| SMILES | CC(C(C1=CC=CC=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)