Products 1416714-03-8
CAS 1416714-03-8 is the registry number for 3-CHLORO-6-NITROISOQUINOLIN-1-OL, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-chloro-6-nitro-2H-isoquinolin-1-one (CAS 1416714-03-8) is a chemical compound with the molecular formula C9H5ClN2O3 and a molecular weight of 224.60 g/mol. IUPAC name: 3-chloro-6-nitro-2H-isoquinolin-1-one. InChIKey: NBYKZZQGZDHPCB-UHFFFAOYSA-N.
| Molecular formula | C9H5ClN2O3 |
|---|---|
| Molecular weight | 224.60 g/mol |
| IUPAC name | 3-chloro-6-nitro-2H-isoquinolin-1-one |
| InChIKey | NBYKZZQGZDHPCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])C=C(NC2=O)Cl |
Computed by PubChem (NCBI)