Products 1416740-16-3
CAS 1416740-16-3 appears in our catalog under these names: 2-Bromo-7-nitro-5h-pyrrolo[2,3-b]pyrazine, 95%, 2–Bromo–7–nitro–5H–pyrrolo(2，3–b)pyrazine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 5g, 100mg, 250mg.
2-bromo-7-nitro-5H-pyrrolo[2,3-b]pyrazine (CAS 1416740-16-3) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 2-bromo-7-nitro-5H-pyrrolo[2,3-b]pyrazine. InChIKey: VQKDSESFZOLVBL-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN4O2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 2-bromo-7-nitro-5H-pyrrolo[2,3-b]pyrazine |
| InChIKey | VQKDSESFZOLVBL-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC(=CN=C2N1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)