Products 2611479-37-7

CAS 2611479-37-7 is the registry number for 6-Bromo-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid (CAS 2611479-37-7) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid. InChIKey: LOPXEFYNIFRRJN-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrN4O2
Molecular weight243.02 g/mol
IUPAC name5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid
InChIKeyLOPXEFYNIFRRJN-UHFFFAOYSA-N
SMILESC1=C(N=C2C(=N1)N=C(N2)C(=O)O)Br

Computed by PubChem (NCBI)