CAS 2611479-37-7 is the registry number for 6-Bromo-1H-imidazo[4,5-b]pyrazine-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid (CAS 2611479-37-7) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid. InChIKey: LOPXEFYNIFRRJN-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN4O2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 5-bromo-3H-imidazo[4,5-b]pyrazine-2-carboxylic acid |
| InChIKey | LOPXEFYNIFRRJN-UHFFFAOYSA-N |
| SMILES | C1=C(N=C2C(=N1)N=C(N2)C(=O)O)Br |
Computed by PubChem (NCBI)