CAS 2155874-56-7 appears in our catalog under these names: 6-Bromo-8-nitro-[1,2,4]triazolo[1,5-a]pyridine, 95%, 6-Bromo-8-nitro-[1,2,4]triazolo[1,5-a]pyridine, ≥98%, ≥98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
6-bromo-8-nitro-[1,2,4]triazolo[1,5-a]pyridine (CAS 2155874-56-7) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 6-bromo-8-nitro-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: OZHYNZLYMGEOJK-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN4O2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 6-bromo-8-nitro-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | OZHYNZLYMGEOJK-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NC=NN2C=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)