Products 300361-78-8

CAS 300361-78-8 is the registry number for 6-Bromo-(1,2,4)triazolo(1,5-a)pyrimidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

6-bromo-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 300361-78-8) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 6-bromo-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: YSENOEHSZPNZDP-UHFFFAOYSA-N.

Identity
Molecular formulaC6H3BrN4O2
Molecular weight243.02 g/mol
IUPAC name6-bromo-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylic acid
InChIKeyYSENOEHSZPNZDP-UHFFFAOYSA-N
SMILESC1=C(C=NC2=NC(=NN21)C(=O)O)Br

Computed by PubChem (NCBI)