CAS 951884-20-1 appears in our catalog under these names: 6-Bromo-8-nitro-[1,2,4]triazolo[4,3-a]pyridine, 98%, 6-Bromo-8-nitro-[1,2,4]triazolo[4,3-a]pyridine, 98%, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 100mg, 250mg.
6-bromo-8-nitro-[1,2,4]triazolo[4,3-a]pyridine (CAS 951884-20-1) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 6-bromo-8-nitro-[1,2,4]triazolo[4,3-a]pyridine. InChIKey: RXPJMXNWABONRU-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN4O2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 6-bromo-8-nitro-[1,2,4]triazolo[4,3-a]pyridine |
| InChIKey | RXPJMXNWABONRU-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NN=CN2C=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)