CAS 2840823-25-6 appears in our catalog under these names: 5-Bromo-4-nitro-1H-benzo(d)(1,2,3)triazole, 98%, 5-Bromo-4-nitro-1H-benzo[d][1,2,3]triazole, ≥95%, ≥95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
5-bromo-4-nitro-2H-benzotriazole (CAS 2840823-25-6) is a chemical compound with the molecular formula C6H3BrN4O2 and a molecular weight of 243.02 g/mol. IUPAC name: 5-bromo-4-nitro-2H-benzotriazole. InChIKey: HESYWWKLDNEEPB-UHFFFAOYSA-N.
| Molecular formula | C6H3BrN4O2 |
|---|---|
| Molecular weight | 243.02 g/mol |
| IUPAC name | 5-bromo-4-nitro-2H-benzotriazole |
| InChIKey | HESYWWKLDNEEPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNN=C2C(=C1Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)